C24H33N5O3 — CID 162643144
5-[(1S)-1-[(1-methylazetidine-3-carbonyl)amino]-7-oxononyl]-2-phenyl-1H-imidazole-4-carboxamide (PubChem CID 162643144) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 5-[(1S)-1-[(1-methylazetidine-3-carbonyl)amino]-7-oxononyl]-2-phenyl-1H-imidazole-4-carboxamide.
| Compound Name | 5-[(1S)-1-[(1-methylazetidine-3-carbonyl)amino]-7-oxononyl]-2-phenyl-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 162643144 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 5-[(1S)-1-[(1-methylazetidine-3-carbonyl)amino]-7-oxononyl]-2-phenyl-1H-imidazole-4-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C1CN(C)C1)c1[nH]c(-c2ccccc2)nc1C(N)=O |
| InChI | InChI=1S/C24H33N5O3/c1-3-18(30)12-8-5-9-13-19(26-24(32)17-14-29(2)15-17)20-21(22(25)31)28-23(27-20)16-10-6-4-7-11-16/h4,6-7,10-11,17,19H,3,5,8-9,12-15H2,1-2H3,(H2,25,31)(H,26,32)(H,27,28)/t19-/m0/s1 |
| InChIKey | XGWNKDSIJSHVCT-IBGZPJMESA-N |
| XLogP | 2.82 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|