C24H35N5O2 — CID 44589488
2-(4-methylpiperazin-1-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]acetamide (PubChem CID 44589488) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]acetamide.
| Compound Name | 2-(4-methylpiperazin-1-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]acetamide |
|---|---|
| PubChem CID | 44589488 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-N-[(1S)-7-oxo-1-(5-phenyl-1H-imidazol-2-yl)octyl]acetamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)CN1CCN(C)CC1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C24H35N5O2/c1-19(30)9-5-3-8-12-21(26-23(31)18-29-15-13-28(2)14-16-29)24-25-17-22(27-24)20-10-6-4-7-11-20/h4,6-7,10-11,17,21H,3,5,8-9,12-16,18H2,1-2H3,(H,25,27)(H,26,31)/t21-/m0/s1 |
| InChIKey | DVRMJBBYHFIUML-NRFANRHFSA-N |
| XLogP | 3.02 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|