carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one

C7H10N2O3 — CID 161475032

IUPACcarbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one
SMILESCCc1c(C)[nH][nH]c1=O.O=C=O
InChIInChI=1S/C6H10N2O.CO2/c1-3-5-4(2)7-8-6(5)9;2-1-3/h3H2,1-2H3,(H2,7,8,9);
InChIKeyWDPIDGAKOJLPDX-UHFFFAOYSA-N
MW170.17 g/mol
LogP-0.01
Rot. Bonds1

About carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one

carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one (PubChem CID 161475032) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one.

Molecular Properties

Compound Namecarbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one
PubChem CID161475032
Molecular FormulaC7H10N2O3
Molecular Weight170.17 g/mol
Exact Mass170.07
IUPAC Namecarbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one
SMILESCCc1c(C)[nH][nH]c1=O.O=C=O
InChIInChI=1S/C6H10N2O.CO2/c1-3-5-4(2)7-8-6(5)9;2-1-3/h3H2,1-2H3,(H2,7,8,9);
InChIKeyWDPIDGAKOJLPDX-UHFFFAOYSA-N
XLogP-0.01
TPSA82.79 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 5-0.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one?
The IUPAC name of carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one (CID 161475032) is carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one.
What is the SMILES notation for carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one?
The canonical SMILES for carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one is CCc1c(C)[nH][nH]c1=O.O=C=O.
What is the InChIKey of carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one?
The InChIKey is WDPIDGAKOJLPDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.CO2/c1-3-5-4(2)7-8-6(5)9;2-1-3/h3H2,1-2H3,(H2,7,8,9);.
What are the key properties of carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one?
carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one has a molecular weight of 170.17 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;4-ethyl-5-methyl-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 161475032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).