C36H60NO2+ — CID 161475841
3-butyl-3-phenylheptanoic acid;(3-butyl-3-phenylheptyl)-dimethylazanium (PubChem CID 161475841) has the molecular formula C36H60NO2+ and a molecular weight of 538.88 g/mol. Its IUPAC name is 3-butyl-3-phenylheptanoic acid;(3-butyl-3-phenylheptyl)-dimethylazanium.
| Compound Name | 3-butyl-3-phenylheptanoic acid;(3-butyl-3-phenylheptyl)-dimethylazanium |
|---|---|
| PubChem CID | 161475841 |
| Molecular Formula | C36H60NO2+ |
| Molecular Weight | 538.88 g/mol |
| Exact Mass | 538.46 |
| IUPAC Name | 3-butyl-3-phenylheptanoic acid;(3-butyl-3-phenylheptyl)-dimethylazanium |
| SMILES | CCCCC(CCCC)(CC(=O)O)c1ccccc1.CCCCC(CCCC)(CC[NH+](C)C)c1ccccc1 |
| InChI | InChI=1S/C19H33N.C17H26O2/c1-5-7-14-19(15-8-6-2,16-17-20(3)4)18-12-10-9-11-13-18;1-3-5-12-17(13-6-4-2,14-16(18)19)15-10-8-7-9-11-15/h9-13H,5-8,14-17H2,1-4H3;7-11H,3-6,12-14H2,1-2H3,(H,18,19)/p+1 |
| InChIKey | AYWOKEQNMNSSOE-UHFFFAOYSA-O |
| XLogP | 8.62 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.88 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |