About 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile
2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile (PubChem CID 161477085) has the molecular formula C17H10F3NO4S
and a molecular weight of 381.33 g/mol. Its IUPAC name is 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile.
Molecular Properties
| Compound Name | 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile |
| PubChem CID | 161477085 |
| Molecular Formula | C17H10F3NO4S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(F)cc2C#N)c2c1C(=O)C(F)(F)C2 |
| InChI | InChI=1S/C17H10F3NO4S/c1-26(23,24)14-5-4-13(11-7-17(19,20)16(22)15(11)14)25-12-3-2-10(18)6-9(12)8-21/h2-6H,7H2,1H3 |
| InChIKey | WDVYXPFIJKCQAK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile?
The IUPAC name of 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile (CID 161477085) is 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile.
What is the SMILES notation for 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile?
The canonical SMILES for 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile is CS(=O)(=O)c1ccc(Oc2ccc(F)cc2C#N)c2c1C(=O)C(F)(F)C2.
What is the InChIKey of 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile?
The InChIKey is WDVYXPFIJKCQAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F3NO4S/c1-26(23,24)14-5-4-13(11-7-17(19,20)16(22)15(11)14)25-12-3-2-10(18)6-9(12)8-21/h2-6H,7H2,1H3.
What are the key properties of 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile?
2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile has a molecular weight of 381.33 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-difluoro-7-methylsulfonyl-1-oxo-3H-inden-4-yl)oxy]-5-fluorobenzonitrile is sourced from PubChem (CID 161477085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).