C27H31FN4O2 — CID 161478657
[3-fluoro-4-(3-piperidin-1-ylpropoxy)phenyl]-(1-methyl-4,10-dihydropyrazolo[4,5-c][1]benzazepin-5-yl)methanone (PubChem CID 161478657) has the molecular formula C27H31FN4O2 and a molecular weight of 462.57 g/mol. Its IUPAC name is [3-fluoro-4-(3-piperidin-1-ylpropoxy)phenyl]-(1-methyl-4,10-dihydropyrazolo[4,5-c][1]benzazepin-5-yl)methanone.
| Compound Name | [3-fluoro-4-(3-piperidin-1-ylpropoxy)phenyl]-(1-methyl-4,10-dihydropyrazolo[4,5-c][1]benzazepin-5-yl)methanone |
|---|---|
| PubChem CID | 161478657 |
| Molecular Formula | C27H31FN4O2 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | [3-fluoro-4-(3-piperidin-1-ylpropoxy)phenyl]-(1-methyl-4,10-dihydropyrazolo[4,5-c][1]benzazepin-5-yl)methanone |
| SMILES | Cn1ncc2c1Cc1ccccc1N(C(=O)c1ccc(OCCCN3CCCCC3)c(F)c1)C2 |
| InChI | InChI=1S/C27H31FN4O2/c1-30-25-17-20-8-3-4-9-24(20)32(19-22(25)18-29-30)27(33)21-10-11-26(23(28)16-21)34-15-7-14-31-12-5-2-6-13-31/h3-4,8-11,16,18H,2,5-7,12-15,17,19H2,1H3 |
| InChIKey | YDTFKYGFYGJYPG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|