C25H32F3N3O3 — CID 161479329
4-octyl-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]piperazine-1-carboxylic acid (PubChem CID 161479329) has the molecular formula C25H32F3N3O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-octyl-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-octyl-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 161479329 |
| Molecular Formula | C25H32F3N3O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 4-octyl-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]piperazine-1-carboxylic acid |
| SMILES | CCCCCCCCN1CCN(C(=O)O)C(c2ccc(Oc3ccc(C(F)(F)F)cn3)cc2)C1 |
| InChI | InChI=1S/C25H32F3N3O3/c1-2-3-4-5-6-7-14-30-15-16-31(24(32)33)22(18-30)19-8-11-21(12-9-19)34-23-13-10-20(17-29-23)25(26,27)28/h8-13,17,22H,2-7,14-16,18H2,1H3,(H,32,33) |
| InChIKey | WEDLWTBVQFXHQK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|