C17H33N3 — CID 161481125
N-[(4-tert-butylpiperazin-1-yl)methyl]-N,4,4-trimethylpent-2-yn-1-amine (PubChem CID 161481125) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is N-[(4-tert-butylpiperazin-1-yl)methyl]-N,4,4-trimethylpent-2-yn-1-amine.
| Compound Name | N-[(4-tert-butylpiperazin-1-yl)methyl]-N,4,4-trimethylpent-2-yn-1-amine |
|---|---|
| PubChem CID | 161481125 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | N-[(4-tert-butylpiperazin-1-yl)methyl]-N,4,4-trimethylpent-2-yn-1-amine |
| SMILES | CN(CC#CC(C)(C)C)CN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H33N3/c1-16(2,3)9-8-10-18(7)15-19-11-13-20(14-12-19)17(4,5)6/h10-15H2,1-7H3 |
| InChIKey | KFVHGFCOEDQSPO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|