C14H23ORb — CID 161486481
(E)-4-methylpent-2-ene;(E,4R)-oct-2-en-6-yn-4-olate;rubidium(1+) (PubChem CID 161486481) has the molecular formula C14H23ORb and a molecular weight of 292.81 g/mol. Its IUPAC name is (E)-4-methylpent-2-ene;(E,4R)-oct-2-en-6-yn-4-olate;rubidium(1+).
| Compound Name | (E)-4-methylpent-2-ene;(E,4R)-oct-2-en-6-yn-4-olate;rubidium(1+) |
|---|---|
| PubChem CID | 161486481 |
| Molecular Formula | C14H23ORb |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (E)-4-methylpent-2-ene;(E,4R)-oct-2-en-6-yn-4-olate;rubidium(1+) |
| SMILES | C/C=C/C(C)C.CC#CC[C@@H]([O-])/C=C/C.[Rb+] |
| InChI | InChI=1S/C8H11O.C6H12.Rb/c1-3-5-7-8(9)6-4-2;1-4-5-6(2)3;/h4,6,8H,7H2,1-2H3;4-6H,1-3H3;/q-1;;+1/b6-4+;5-4+;/t8-;;/m0../s1 |
| InChIKey | WFARRFFIMRVKAZ-ASYISTDESA-N |
| XLogP | -0.07 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|