C21H20N6O — CID 161487639
2-[8-amino-9-(2-methylphenyl)-2-(4-methylphenyl)purin-6-yl]-2-iminoethanol (PubChem CID 161487639) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[8-amino-9-(2-methylphenyl)-2-(4-methylphenyl)purin-6-yl]-2-iminoethanol.
| Compound Name | 2-[8-amino-9-(2-methylphenyl)-2-(4-methylphenyl)purin-6-yl]-2-iminoethanol |
|---|---|
| PubChem CID | 161487639 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[8-amino-9-(2-methylphenyl)-2-(4-methylphenyl)purin-6-yl]-2-iminoethanol |
| SMILES | [H]/N=C(\CO)c1nc(-c2ccc(C)cc2)nc2c1nc(N)n2-c1ccccc1C |
| InChI | InChI=1S/C21H20N6O/c1-12-7-9-14(10-8-12)19-24-17(15(22)11-28)18-20(26-19)27(21(23)25-18)16-6-4-3-5-13(16)2/h3-10,22,28H,11H2,1-2H3,(H2,23,25)/b22-15+ |
| InChIKey | UPWCKHKKOHYCBO-PXLXIMEGSA-N |
| XLogP | 3.04 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|