C17H21FN4O3 — CID 161488929
tert-butyl N-[3-fluoro-2-[[4-(4-hydroxyphenyl)triazol-2-yl]methyl]prop-2-enyl]carbamate (PubChem CID 161488929) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is tert-butyl N-[3-fluoro-2-[[4-(4-hydroxyphenyl)triazol-2-yl]methyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-fluoro-2-[[4-(4-hydroxyphenyl)triazol-2-yl]methyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 161488929 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | tert-butyl N-[3-fluoro-2-[[4-(4-hydroxyphenyl)triazol-2-yl]methyl]prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=CF)Cn1ncc(-c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C17H21FN4O3/c1-17(2,3)25-16(24)19-9-12(8-18)11-22-20-10-15(21-22)13-4-6-14(23)7-5-13/h4-8,10,23H,9,11H2,1-3H3,(H,19,24) |
| InChIKey | FZJXEFUEKYVYIQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |