2-propylpentanoic acid;2-propylpent-2-enoic acid

C16H30O4 — CID 161489381

IUPAC2-propylpentanoic acid;2-propylpent-2-enoic acid
SMILESCCC=C(CCC)C(=O)O.CCCC(CCC)C(=O)O
InChIInChI=1S/C8H16O2.C8H14O2/c2*1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10);5H,3-4,6H2,1-2H3,(H,9,10)
InChIKeyWFKCCMYKKDIYCI-UHFFFAOYSA-N
MW286.41 g/mol
LogP4.49
Rot. Bonds9

About 2-propylpentanoic acid;2-propylpent-2-enoic acid

2-propylpentanoic acid;2-propylpent-2-enoic acid (PubChem CID 161489381) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 2-propylpentanoic acid;2-propylpent-2-enoic acid.

Molecular Properties

Compound Name2-propylpentanoic acid;2-propylpent-2-enoic acid
PubChem CID161489381
Molecular FormulaC16H30O4
Molecular Weight286.41 g/mol
Exact Mass286.21
IUPAC Name2-propylpentanoic acid;2-propylpent-2-enoic acid
SMILESCCC=C(CCC)C(=O)O.CCCC(CCC)C(=O)O
InChIInChI=1S/C8H16O2.C8H14O2/c2*1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10);5H,3-4,6H2,1-2H3,(H,9,10)
InChIKeyWFKCCMYKKDIYCI-UHFFFAOYSA-N
XLogP4.49
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.41
LogP ≤ 54.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-propylpentanoic acid;2-propylpent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propylpentanoic acid;2-propylpent-2-enoic acid?
The IUPAC name of 2-propylpentanoic acid;2-propylpent-2-enoic acid (CID 161489381) is 2-propylpentanoic acid;2-propylpent-2-enoic acid.
What is the SMILES notation for 2-propylpentanoic acid;2-propylpent-2-enoic acid?
The canonical SMILES for 2-propylpentanoic acid;2-propylpent-2-enoic acid is CCC=C(CCC)C(=O)O.CCCC(CCC)C(=O)O.
What is the InChIKey of 2-propylpentanoic acid;2-propylpent-2-enoic acid?
The InChIKey is WFKCCMYKKDIYCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C8H14O2/c2*1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10);5H,3-4,6H2,1-2H3,(H,9,10).
What are the key properties of 2-propylpentanoic acid;2-propylpent-2-enoic acid?
2-propylpentanoic acid;2-propylpent-2-enoic acid has a molecular weight of 286.41 g/mol, XLogP of 4.49, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpentanoic acid;2-propylpent-2-enoic acid is sourced from PubChem (CID 161489381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).