C16H28O — CID 161489982
[(1R,4Z,8S)-4,5-di(propan-2-yl)-9-bicyclo[6.1.0]non-4-enyl]methanol (PubChem CID 161489982) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is [(1R,4Z,8S)-4,5-di(propan-2-yl)-9-bicyclo[6.1.0]non-4-enyl]methanol.
| Compound Name | [(1R,4Z,8S)-4,5-di(propan-2-yl)-9-bicyclo[6.1.0]non-4-enyl]methanol |
|---|---|
| PubChem CID | 161489982 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | [(1R,4Z,8S)-4,5-di(propan-2-yl)-9-bicyclo[6.1.0]non-4-enyl]methanol |
| SMILES | CC(C)/C1=C(\C(C)C)CC[C@H]2C(CO)[C@H]2CC1 |
| InChI | InChI=1S/C16H28O/c1-10(2)12-5-7-14-15(16(14)9-17)8-6-13(12)11(3)4/h10-11,14-17H,5-9H2,1-4H3/b13-12-/t14-,15+,16? |
| InChIKey | WFLZGSGQJVZIAI-DFMJVRNZSA-N |
| XLogP | 4.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|