C26H47NO2 — CID 172528266
[(1R,4Z,8S)-4,5-di(propan-2-yl)-9-bicyclo[6.1.0]non-4-enyl]methyl N-(7-methyloctyl)carbamate (PubChem CID 172528266) has the molecular formula C26H47NO2 and a molecular weight of 405.67 g/mol. Its IUPAC name is [(1R,4Z,8S)-4,5-di(propan-2-yl)-9-bicyclo[6.1.0]non-4-enyl]methyl N-(7-methyloctyl)carbamate.
| Compound Name | [(1R,4Z,8S)-4,5-di(propan-2-yl)-9-bicyclo[6.1.0]non-4-enyl]methyl N-(7-methyloctyl)carbamate |
|---|---|
| PubChem CID | 172528266 |
| Molecular Formula | C26H47NO2 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.36 |
| IUPAC Name | [(1R,4Z,8S)-4,5-di(propan-2-yl)-9-bicyclo[6.1.0]non-4-enyl]methyl N-(7-methyloctyl)carbamate |
| SMILES | CC(C)CCCCCCNC(=O)OCC1[C@H]2CC/C(C(C)C)=C(/C(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C26H47NO2/c1-18(2)11-9-7-8-10-16-27-26(28)29-17-25-23-14-12-21(19(3)4)22(20(5)6)13-15-24(23)25/h18-20,23-25H,7-17H2,1-6H3,(H,27,28)/b22-21-/t23-,24+,25? |
| InChIKey | KVZGSBSXKKHGRU-PZOMBYPESA-N |
| XLogP | 7.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|