C26H37N3O4 — CID 168801078
[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethylamino]ethyl]carbamate (PubChem CID 168801078) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is [(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethylamino]ethyl]carbamate.
| Compound Name | [(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 168801078 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | [(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethylamino]ethyl]carbamate |
| SMILES | O=C(NCCNCCNC(=O)OCC1[C@H]2CCC#CCC[C@@H]12)OCC1[C@H]2CCC#CCC[C@@H]12 |
| InChI | InChI=1S/C26H37N3O4/c30-25(32-17-23-19-9-5-1-2-6-10-20(19)23)28-15-13-27-14-16-29-26(31)33-18-24-21-11-7-3-4-8-12-22(21)24/h19-24,27H,5-18H2,(H,28,30)(H,29,31)/t19-,20+,21-,22+,23?,24? |
| InChIKey | FWTXWTNRJCQMSO-QVGYUHCVSA-N |
| XLogP | 2.91 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|