C33H47NO10 — CID 155646072
2-[2-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonyloxy]ethoxy]ethoxy]ethoxy]ethyl 3-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]propanoate (PubChem CID 155646072) has the molecular formula C33H47NO10 and a molecular weight of 617.74 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonyloxy]ethoxy]ethoxy]ethoxy]ethyl 3-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]propanoate.
| Compound Name | 2-[2-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonyloxy]ethoxy]ethoxy]ethoxy]ethyl 3-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 155646072 |
| Molecular Formula | C33H47NO10 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | 2-[2-[2-[2-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonyloxy]ethoxy]ethoxy]ethoxy]ethyl 3-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]propanoate |
| SMILES | O=C(CCNC(=O)OCC1[C@H]2CCC#CCC[C@@H]12)OCCOCCOCCOCCOC(=O)OCC1[C@H]2CCC#CCC[C@@H]12 |
| InChI | InChI=1S/C33H47NO10/c35-31(13-14-34-32(36)43-23-29-25-9-5-1-2-6-10-26(25)29)41-21-19-39-17-15-38-16-18-40-20-22-42-33(37)44-24-30-27-11-7-3-4-8-12-28(27)30/h25-30H,5-24H2,(H,34,36)/t25-,26+,27-,28+,29?,30? |
| InChIKey | GGWLHGLBBNKTBJ-QHNOGPKKSA-N |
| XLogP | 3.73 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|