C21H20F5NO5 — CID 168721948
(2,3,4,5,6-pentafluorophenyl) 3-[2-(8-bicyclo[5.1.0]oct-3-ynylmethoxycarbonylamino)ethoxy]propanoate (PubChem CID 168721948) has the molecular formula C21H20F5NO5 and a molecular weight of 461.38 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-(8-bicyclo[5.1.0]oct-3-ynylmethoxycarbonylamino)ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-(8-bicyclo[5.1.0]oct-3-ynylmethoxycarbonylamino)ethoxy]propanoate |
|---|---|
| PubChem CID | 168721948 |
| Molecular Formula | C21H20F5NO5 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-(8-bicyclo[5.1.0]oct-3-ynylmethoxycarbonylamino)ethoxy]propanoate |
| SMILES | O=C(CCOCCNC(=O)OCC1C2CC#CCCC21)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H20F5NO5/c22-15-16(23)18(25)20(19(26)17(15)24)32-14(28)6-8-30-9-7-27-21(29)31-10-13-11-4-2-1-3-5-12(11)13/h11-13H,2,4-10H2,(H,27,29) |
| InChIKey | ADTZLXNMFOEFPJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|