C26H30F5NO5 — CID 175630380
(2,3,4,5,6-pentafluorophenyl) 4-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)-2-methylpropoxy]pentanoate (PubChem CID 175630380) has the molecular formula C26H30F5NO5 and a molecular weight of 531.52 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)-2-methylpropoxy]pentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)-2-methylpropoxy]pentanoate |
|---|---|
| PubChem CID | 175630380 |
| Molecular Formula | C26H30F5NO5 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[2-(9-bicyclo[6.1.0]non-4-ynylmethoxycarbonylamino)-2-methylpropoxy]pentanoate |
| SMILES | CC(CCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)OCC(C)(C)NC(=O)OCC1C2CCC#CCCC21 |
| InChI | InChI=1S/C26H30F5NO5/c1-14(10-11-18(33)37-24-22(30)20(28)19(27)21(29)23(24)31)36-13-26(2,3)32-25(34)35-12-17-15-8-6-4-5-7-9-16(15)17/h14-17H,6-13H2,1-3H3,(H,32,34) |
| InChIKey | ZVRBSTLNMNMZKA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|