C24H39NO5 — CID 129308847
9-bicyclo[6.1.0]non-4-ynylmethyl N-[3-methyl-3-[3-methyl-3-(3-oxopropoxy)butoxy]butyl]carbamate (PubChem CID 129308847) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is 9-bicyclo[6.1.0]non-4-ynylmethyl N-[3-methyl-3-[3-methyl-3-(3-oxopropoxy)butoxy]butyl]carbamate.
| Compound Name | 9-bicyclo[6.1.0]non-4-ynylmethyl N-[3-methyl-3-[3-methyl-3-(3-oxopropoxy)butoxy]butyl]carbamate |
|---|---|
| PubChem CID | 129308847 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 9-bicyclo[6.1.0]non-4-ynylmethyl N-[3-methyl-3-[3-methyl-3-(3-oxopropoxy)butoxy]butyl]carbamate |
| SMILES | CC(C)(CCNC(=O)OCC1C2CCC#CCCC21)OCCC(C)(C)OCCC=O |
| InChI | InChI=1S/C24H39NO5/c1-23(2,30-17-13-24(3,4)29-16-9-15-26)12-14-25-22(27)28-18-21-19-10-7-5-6-8-11-20(19)21/h15,19-21H,7-14,16-18H2,1-4H3,(H,25,27) |
| InChIKey | MCQUFNVIZRGQTD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|