C18H29NO4S2 — CID 167151238
9-bicyclo[6.1.0]non-4-ynylmethyl N-[2-[3-(2-hydroxyethyldisulfanyl)propoxy]ethyl]carbamate (PubChem CID 167151238) has the molecular formula C18H29NO4S2 and a molecular weight of 387.57 g/mol. Its IUPAC name is 9-bicyclo[6.1.0]non-4-ynylmethyl N-[2-[3-(2-hydroxyethyldisulfanyl)propoxy]ethyl]carbamate.
| Compound Name | 9-bicyclo[6.1.0]non-4-ynylmethyl N-[2-[3-(2-hydroxyethyldisulfanyl)propoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 167151238 |
| Molecular Formula | C18H29NO4S2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 9-bicyclo[6.1.0]non-4-ynylmethyl N-[2-[3-(2-hydroxyethyldisulfanyl)propoxy]ethyl]carbamate |
| SMILES | O=C(NCCOCCCSSCCO)OCC1C2CCC#CCCC21 |
| InChI | InChI=1S/C18H29NO4S2/c20-9-13-25-24-12-5-10-22-11-8-19-18(21)23-14-17-15-6-3-1-2-4-7-16(15)17/h15-17,20H,3-14H2,(H,19,21) |
| InChIKey | YBWJKTPLTPDPGD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|