C13H19NO6P- — CID 169303589
2-[[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethyl hydrogen phosphate (PubChem CID 169303589) has the molecular formula C13H19NO6P- and a molecular weight of 316.27 g/mol. Its IUPAC name is 2-[[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethyl hydrogen phosphate.
| Compound Name | 2-[[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 169303589 |
| Molecular Formula | C13H19NO6P- |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]ethyl hydrogen phosphate |
| SMILES | O=C(NCCOP(=O)([O-])O)OCC1[C@H]2CCC#CCC[C@@H]12 |
| InChI | InChI=1S/C13H20NO6P/c15-13(14-7-8-20-21(16,17)18)19-9-12-10-5-3-1-2-4-6-11(10)12/h10-12H,3-9H2,(H,14,15)(H2,16,17,18)/p-1/t10-,11+,12? |
| InChIKey | HOVPHDRXEKTRKH-FOSCPWQOSA-M |
| XLogP | 0.63 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|