C30H52N2O9 — CID 170071872
9-bicyclo[6.1.0]non-4-ynylmethyl N-[2-[2-[2-[2-[2-[2-[3-(butylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 170071872) has the molecular formula C30H52N2O9 and a molecular weight of 584.75 g/mol. Its IUPAC name is 9-bicyclo[6.1.0]non-4-ynylmethyl N-[2-[2-[2-[2-[2-[2-[3-(butylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 9-bicyclo[6.1.0]non-4-ynylmethyl N-[2-[2-[2-[2-[2-[2-[3-(butylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170071872 |
| Molecular Formula | C30H52N2O9 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | 9-bicyclo[6.1.0]non-4-ynylmethyl N-[2-[2-[2-[2-[2-[2-[3-(butylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CCCCNC(=O)CCOCCOCCOCCOCCOCCOCCNC(=O)OCC1C2CCC#CCCC21 |
| InChI | InChI=1S/C30H52N2O9/c1-2-3-11-31-29(33)10-13-35-15-17-37-19-21-39-23-24-40-22-20-38-18-16-36-14-12-32-30(34)41-25-28-26-8-6-4-5-7-9-27(26)28/h26-28H,2-3,6-25H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | VHMKAEULVVNPCI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|