C42H68N2O9 — CID 170000131
2-[2-[7-[[(1S,2R,3S)-2-but-3-enyl-3-butylcyclopropyl]methoxycarbonylamino]heptanoyloxy]ethoxy]ethyl 7-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]heptanoate (PubChem CID 170000131) has the molecular formula C42H68N2O9 and a molecular weight of 745.01 g/mol. Its IUPAC name is 2-[2-[7-[[(1S,2R,3S)-2-but-3-enyl-3-butylcyclopropyl]methoxycarbonylamino]heptanoyloxy]ethoxy]ethyl 7-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]heptanoate.
| Compound Name | 2-[2-[7-[[(1S,2R,3S)-2-but-3-enyl-3-butylcyclopropyl]methoxycarbonylamino]heptanoyloxy]ethoxy]ethyl 7-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]heptanoate |
|---|---|
| PubChem CID | 170000131 |
| Molecular Formula | C42H68N2O9 |
| Molecular Weight | 745.01 g/mol |
| Exact Mass | 744.49 |
| IUPAC Name | 2-[2-[7-[[(1S,2R,3S)-2-but-3-enyl-3-butylcyclopropyl]methoxycarbonylamino]heptanoyloxy]ethoxy]ethyl 7-[[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methoxycarbonylamino]heptanoate |
| SMILES | C=CCC[C@@H]1[C@H](CCCC)[C@@H]1COC(=O)NCCCCCCC(=O)OCCOCCOC(=O)CCCCCCNC(=O)OCC1[C@H]2CCC#CCC[C@@H]12 |
| InChI | InChI=1S/C42H68N2O9/c1-3-5-19-33-34(20-6-4-2)37(33)31-52-41(47)43-25-17-11-9-15-23-39(45)50-29-27-49-28-30-51-40(46)24-16-10-12-18-26-44-42(48)53-32-38-35-21-13-7-8-14-22-36(35)38/h3,33-38H,1,4-6,9-32H2,2H3,(H,43,47)(H,44,48)/t33-,34+,35-,36+,37-,38?/m1/s1 |
| InChIKey | RIISZMWGDDDZHE-LKEBFVIHSA-N |
| XLogP | 7.90 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.01 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|