C24H40N2O6 — CID 134575563
3-[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]-N-[2-[2-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 134575563) has the molecular formula C24H40N2O6 and a molecular weight of 452.59 g/mol. Its IUPAC name is 3-[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]-N-[2-[2-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 3-[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]-N-[2-[2-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 134575563 |
| Molecular Formula | C24H40N2O6 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 3-[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]-N-[2-[2-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CNC(=O)CCOCCOCCOCCOCCNC(=O)CCC1[C@H]2CCC#CCC[C@@H]12 |
| InChI | InChI=1S/C24H40N2O6/c1-25-23(27)10-12-29-14-16-31-18-19-32-17-15-30-13-11-26-24(28)9-8-22-20-6-4-2-3-5-7-21(20)22/h20-22H,4-19H2,1H3,(H,25,27)(H,26,28)/t20-,21+,22? |
| InChIKey | FZIUCHBPDGCRRJ-CBQGHPETSA-N |
| XLogP | 1.52 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|