C20H38N2O4S2 — CID 159072571
5-(2,3-dimethyl-1,4-dithiepan-5-yl)-N-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethyl]pentanamide (PubChem CID 159072571) has the molecular formula C20H38N2O4S2 and a molecular weight of 434.67 g/mol. Its IUPAC name is 5-(2,3-dimethyl-1,4-dithiepan-5-yl)-N-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-(2,3-dimethyl-1,4-dithiepan-5-yl)-N-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 159072571 |
| Molecular Formula | C20H38N2O4S2 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 5-(2,3-dimethyl-1,4-dithiepan-5-yl)-N-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethyl]pentanamide |
| SMILES | CNC(=O)CCOCCOCCNC(=O)CCCCC1CCSC(C)C(C)S1 |
| InChI | InChI=1S/C20H38N2O4S2/c1-16-17(2)28-18(9-15-27-16)6-4-5-7-20(24)22-10-12-26-14-13-25-11-8-19(23)21-3/h16-18H,4-15H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | JZVUBUFWWKNDCU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|