C27H30N2O6 — CID 174986792
2-(2,5-dioxopyrrolidin-1-yl)-8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid (PubChem CID 174986792) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid |
|---|---|
| PubChem CID | 174986792 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid |
| SMILES | O=C(NCCCCCCC(C(=O)O)N1C(=O)CCC1=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H30N2O6/c30-24-14-15-25(31)29(24)23(26(32)33)13-3-1-2-8-16-28-27(34)35-17-22-20-11-6-4-9-18(20)19-10-5-7-12-21(19)22/h4-7,9-12,22-23H,1-3,8,13-17H2,(H,28,34)(H,32,33) |
| InChIKey | AIWYIOJBGVLRMZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|