C15H23ClN2O2 — CID 161499229
(2R,3S)-3-amino-4-(3-chlorophenyl)-1-(oxan-4-ylamino)butan-2-ol (PubChem CID 161499229) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-(3-chlorophenyl)-1-(oxan-4-ylamino)butan-2-ol.
| Compound Name | (2R,3S)-3-amino-4-(3-chlorophenyl)-1-(oxan-4-ylamino)butan-2-ol |
|---|---|
| PubChem CID | 161499229 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2R,3S)-3-amino-4-(3-chlorophenyl)-1-(oxan-4-ylamino)butan-2-ol |
| SMILES | N[C@@H](Cc1cccc(Cl)c1)[C@H](O)CNC1CCOCC1 |
| InChI | InChI=1S/C15H23ClN2O2/c16-12-3-1-2-11(8-12)9-14(17)15(19)10-18-13-4-6-20-7-5-13/h1-3,8,13-15,18-19H,4-7,9-10,17H2/t14-,15+/m0/s1 |
| InChIKey | WGPRJZQJQIBOJD-LSDHHAIUSA-N |
| XLogP | 1.34 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |