C18H19Cl2N — CID 79433698
N-[2,3-bis(3-chlorophenyl)propyl]cyclopropanamine (PubChem CID 79433698) has the molecular formula C18H19Cl2N and a molecular weight of 320.26 g/mol. Its IUPAC name is N-[2,3-bis(3-chlorophenyl)propyl]cyclopropanamine.
| Compound Name | N-[2,3-bis(3-chlorophenyl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 79433698 |
| Molecular Formula | C18H19Cl2N |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[2,3-bis(3-chlorophenyl)propyl]cyclopropanamine |
| SMILES | Clc1cccc(CC(CNC2CC2)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C18H19Cl2N/c19-16-5-1-3-13(10-16)9-15(12-21-18-7-8-18)14-4-2-6-17(20)11-14/h1-6,10-11,15,18,21H,7-9,12H2 |
| InChIKey | LEQIUWQZPFUMEA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |