C16H18ClNS — CID 79442652
N-[2-(3-chlorophenyl)-3-thiophen-3-ylpropyl]cyclopropanamine (PubChem CID 79442652) has the molecular formula C16H18ClNS and a molecular weight of 291.85 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-3-thiophen-3-ylpropyl]cyclopropanamine.
| Compound Name | N-[2-(3-chlorophenyl)-3-thiophen-3-ylpropyl]cyclopropanamine |
|---|---|
| PubChem CID | 79442652 |
| Molecular Formula | C16H18ClNS |
| Molecular Weight | 291.85 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[2-(3-chlorophenyl)-3-thiophen-3-ylpropyl]cyclopropanamine |
| SMILES | Clc1cccc(C(CNC2CC2)Cc2ccsc2)c1 |
| InChI | InChI=1S/C16H18ClNS/c17-15-3-1-2-13(9-15)14(10-18-16-4-5-16)8-12-6-7-19-11-12/h1-3,6-7,9,11,14,16,18H,4-5,8,10H2 |
| InChIKey | OFONXCHLNMQOGY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |