C17H18Cl2N2 — CID 79433687
N-[2-(3-chlorophenyl)-3-(3-chloro-4-pyridinyl)propyl]cyclopropanamine (PubChem CID 79433687) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-3-(3-chloro-4-pyridinyl)propyl]cyclopropanamine.
| Compound Name | N-[2-(3-chlorophenyl)-3-(3-chloro-4-pyridinyl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 79433687 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-[2-(3-chlorophenyl)-3-(3-chloro-4-pyridinyl)propyl]cyclopropanamine |
| SMILES | Clc1cccc(C(CNC2CC2)Cc2ccncc2Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2/c18-15-3-1-2-12(9-15)14(10-21-16-4-5-16)8-13-6-7-20-11-17(13)19/h1-3,6-7,9,11,14,16,21H,4-5,8,10H2 |
| InChIKey | GIKPRALIBLAFIX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |