C17H20Cl2N2 — CID 79433408
2-(3-chlorophenyl)-3-(3-chloro-4-pyridinyl)-N-propylpropan-1-amine (PubChem CID 79433408) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-(3-chloro-4-pyridinyl)-N-propylpropan-1-amine.
| Compound Name | 2-(3-chlorophenyl)-3-(3-chloro-4-pyridinyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 79433408 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-(3-chlorophenyl)-3-(3-chloro-4-pyridinyl)-N-propylpropan-1-amine |
| SMILES | CCCNCC(Cc1ccncc1Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N2/c1-2-7-20-11-15(13-4-3-5-16(18)10-13)9-14-6-8-21-12-17(14)19/h3-6,8,10,12,15,20H,2,7,9,11H2,1H3 |
| InChIKey | RLBBQQUMPPCODF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|