C27H35ClN2O7S2 — CID 172838283
(2R,3S)-3-amino-4-(3-chlorophenyl)-1-(cyclopropylamino)butan-2-ol;bis(4-methylbenzenesulfonic acid) (PubChem CID 172838283) has the molecular formula C27H35ClN2O7S2 and a molecular weight of 599.17 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-(3-chlorophenyl)-1-(cyclopropylamino)butan-2-ol;bis(4-methylbenzenesulfonic acid).
| Compound Name | (2R,3S)-3-amino-4-(3-chlorophenyl)-1-(cyclopropylamino)butan-2-ol;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 172838283 |
| Molecular Formula | C27H35ClN2O7S2 |
| Molecular Weight | 599.17 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | (2R,3S)-3-amino-4-(3-chlorophenyl)-1-(cyclopropylamino)butan-2-ol;bis(4-methylbenzenesulfonic acid) |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.N[C@@H](Cc1cccc(Cl)c1)[C@H](O)CNC1CC1 |
| InChI | InChI=1S/C13H19ClN2O.2C7H8O3S/c14-10-3-1-2-9(6-10)7-12(15)13(17)8-16-11-4-5-11;2*1-6-2-4-7(5-3-6)11(8,9)10/h1-3,6,11-13,16-17H,4-5,7-8,15H2;2*2-5H,1H3,(H,8,9,10)/t12-,13+;;/m0../s1 |
| InChIKey | WLJPPTMZPAOCBO-CQSOCPNPSA-N |
| XLogP | 3.81 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|