C15H24O4Si2 — CID 162004312
[[(2-hydroxyphenyl)methyl-dimethylsilyl]oxy-methylsilyl]methyl 2-methylprop-2-enoate (PubChem CID 162004312) has the molecular formula C15H24O4Si2 and a molecular weight of 324.53 g/mol. Its IUPAC name is [[(2-hydroxyphenyl)methyl-dimethylsilyl]oxy-methylsilyl]methyl 2-methylprop-2-enoate.
| Compound Name | [[(2-hydroxyphenyl)methyl-dimethylsilyl]oxy-methylsilyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162004312 |
| Molecular Formula | C15H24O4Si2 |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [[(2-hydroxyphenyl)methyl-dimethylsilyl]oxy-methylsilyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[SiH](C)O[Si](C)(C)Cc1ccccc1O |
| InChI | InChI=1S/C15H24O4Si2/c1-12(2)15(17)18-11-20(3)19-21(4,5)10-13-8-6-7-9-14(13)16/h6-9,16,20H,1,10-11H2,2-5H3 |
| InChIKey | NDYLRAYYIJDTFA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|