C34H56N4 — CID 162004847
2-tert-butyl-1,3,5-trimethylbenzene;4-tert-butyl-1,3,5-trimethylpyrazole;5-tert-butyl-2,4,6-trimethylpyrimidine (PubChem CID 162004847) has the molecular formula C34H56N4 and a molecular weight of 520.85 g/mol. Its IUPAC name is 2-tert-butyl-1,3,5-trimethylbenzene;4-tert-butyl-1,3,5-trimethylpyrazole;5-tert-butyl-2,4,6-trimethylpyrimidine.
| Compound Name | 2-tert-butyl-1,3,5-trimethylbenzene;4-tert-butyl-1,3,5-trimethylpyrazole;5-tert-butyl-2,4,6-trimethylpyrimidine |
|---|---|
| PubChem CID | 162004847 |
| Molecular Formula | C34H56N4 |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.45 |
| IUPAC Name | 2-tert-butyl-1,3,5-trimethylbenzene;4-tert-butyl-1,3,5-trimethylpyrazole;5-tert-butyl-2,4,6-trimethylpyrimidine |
| SMILES | Cc1cc(C)c(C(C)(C)C)c(C)c1.Cc1nc(C)c(C(C)(C)C)c(C)n1.Cc1nn(C)c(C)c1C(C)(C)C |
| InChI | InChI=1S/C13H20.C11H18N2.C10H18N2/c1-9-7-10(2)12(11(3)8-9)13(4,5)6;1-7-10(11(4,5)6)8(2)13-9(3)12-7;1-7-9(10(3,4)5)8(2)12(6)11-7/h7-8H,1-6H3;1-6H3;1-6H3 |
| InChIKey | YSRSAIYXTBBUHJ-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |