C22H50O3 — CID 162007152
2-methyl-1-(2-methylpropoxy)propane;2-methyl-1-[2-(2-methylpropoxy)propoxy]propane;propane (PubChem CID 162007152) has the molecular formula C22H50O3 and a molecular weight of 362.64 g/mol. Its IUPAC name is 2-methyl-1-(2-methylpropoxy)propane;2-methyl-1-[2-(2-methylpropoxy)propoxy]propane;propane.
| Compound Name | 2-methyl-1-(2-methylpropoxy)propane;2-methyl-1-[2-(2-methylpropoxy)propoxy]propane;propane |
|---|---|
| PubChem CID | 162007152 |
| Molecular Formula | C22H50O3 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 362.38 |
| IUPAC Name | 2-methyl-1-(2-methylpropoxy)propane;2-methyl-1-[2-(2-methylpropoxy)propoxy]propane;propane |
| SMILES | CC(C)COCC(C)C.CC(C)COCC(C)OCC(C)C.CCC |
| InChI | InChI=1S/C11H24O2.C8H18O.C3H8/c1-9(2)6-12-8-11(5)13-7-10(3)4;1-7(2)5-9-6-8(3)4;1-3-2/h9-11H,6-8H2,1-5H3;7-8H,5-6H2,1-4H3;3H2,1-2H3 |
| InChIKey | YSZFNMOZODJWAS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |