C19H33N3O5 — CID 162010441
ethyl (2R,3R)-3-[(3R)-3-[(6-amino-6-iminohexyl)carbamoyl]-5-methylhexanoyl]oxirane-2-carboxylate (PubChem CID 162010441) has the molecular formula C19H33N3O5 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[(3R)-3-[(6-amino-6-iminohexyl)carbamoyl]-5-methylhexanoyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2R,3R)-3-[(3R)-3-[(6-amino-6-iminohexyl)carbamoyl]-5-methylhexanoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 162010441 |
| Molecular Formula | C19H33N3O5 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | ethyl (2R,3R)-3-[(3R)-3-[(6-amino-6-iminohexyl)carbamoyl]-5-methylhexanoyl]oxirane-2-carboxylate |
| SMILES | [H]/N=C(\N)CCCCCNC(=O)[C@@H](CC(=O)[C@@H]1O[C@H]1C(=O)OCC)CC(C)C |
| InChI | InChI=1S/C19H33N3O5/c1-4-26-19(25)17-16(27-17)14(23)11-13(10-12(2)3)18(24)22-9-7-5-6-8-15(20)21/h12-13,16-17H,4-11H2,1-3H3,(H3,20,21)(H,22,24)/t13-,16+,17-/m1/s1 |
| InChIKey | GWLAPEGJZQCIJB-XOKHGSTOSA-N |
| XLogP | 1.55 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|