C38H59N5O5 — CID 162014833
tert-butyl (3S)-3-[(2-aminophenyl)methyl]piperidine-1-carboxylate;tert-butyl 3-[2-(pentanoylamino)anilino]piperidine-1-carboxylate (PubChem CID 162014833) has the molecular formula C38H59N5O5 and a molecular weight of 665.92 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2-aminophenyl)methyl]piperidine-1-carboxylate;tert-butyl 3-[2-(pentanoylamino)anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(2-aminophenyl)methyl]piperidine-1-carboxylate;tert-butyl 3-[2-(pentanoylamino)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162014833 |
| Molecular Formula | C38H59N5O5 |
| Molecular Weight | 665.92 g/mol |
| Exact Mass | 665.45 |
| IUPAC Name | tert-butyl (3S)-3-[(2-aminophenyl)methyl]piperidine-1-carboxylate;tert-butyl 3-[2-(pentanoylamino)anilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Cc2ccccc2N)C1.CCCCC(=O)Nc1ccccc1NC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H33N3O3.C17H26N2O2/c1-5-6-13-19(25)23-18-12-8-7-11-17(18)22-16-10-9-14-24(15-16)20(26)27-21(2,3)4;1-17(2,3)21-16(20)19-10-6-7-13(12-19)11-14-8-4-5-9-15(14)18/h7-8,11-12,16,22H,5-6,9-10,13-15H2,1-4H3,(H,23,25);4-5,8-9,13H,6-7,10-12,18H2,1-3H3/t;13-/m.0/s1 |
| InChIKey | YTYSJUVEAIVKAZ-RSJBZBQMSA-N |
| XLogP | 8.09 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.92 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|