About tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid
tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid (PubChem CID 162016454) has the molecular formula C15H20ClNO3Si
and a molecular weight of 325.87 g/mol. Its IUPAC name is tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid |
| PubChem CID | 162016454 |
| Molecular Formula | C15H20ClNO3Si |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid |
| SMILES | C[SiH2]C(C)(C)C.O=C(O)c1cc2cccc(O)c2nc1Cl |
| InChI | InChI=1S/C10H6ClNO3.C5H14Si/c11-9-6(10(14)15)4-5-2-1-3-7(13)8(5)12-9;1-5(2,3)6-4/h1-4,13H,(H,14,15);6H2,1-4H3 |
| InChIKey | YUEANZCHLJCESM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid?
The IUPAC name of tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid (CID 162016454) is tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid.
What is the SMILES notation for tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid?
The canonical SMILES for tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid is C[SiH2]C(C)(C)C.O=C(O)c1cc2cccc(O)c2nc1Cl.
What is the InChIKey of tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid?
The InChIKey is YUEANZCHLJCESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClNO3.C5H14Si/c11-9-6(10(14)15)4-5-2-1-3-7(13)8(5)12-9;1-5(2,3)6-4/h1-4,13H,(H,14,15);6H2,1-4H3.
What are the key properties of tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid?
tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid has a molecular weight of 325.87 g/mol, XLogP of 3.71, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(methyl)silane;2-chloro-8-hydroxyquinoline-3-carboxylic acid is sourced from PubChem (CID 162016454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).