C29H30O3S — CID 162020954
[6-hydroxy-3-(4-pentylphenoxy)-1-benzothiophen-2-yl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 162020954) has the molecular formula C29H30O3S and a molecular weight of 458.62 g/mol. Its IUPAC name is [6-hydroxy-3-(4-pentylphenoxy)-1-benzothiophen-2-yl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [6-hydroxy-3-(4-pentylphenoxy)-1-benzothiophen-2-yl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 162020954 |
| Molecular Formula | C29H30O3S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [6-hydroxy-3-(4-pentylphenoxy)-1-benzothiophen-2-yl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCCCCc1ccc(Oc2c(C(=O)c3c(C)cc(C)cc3C)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C29H30O3S/c1-5-6-7-8-21-9-12-23(13-10-21)32-28-24-14-11-22(30)17-25(24)33-29(28)27(31)26-19(3)15-18(2)16-20(26)4/h9-17,30H,5-8H2,1-4H3 |
| InChIKey | GVSOBTBBJGEJGH-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|