About 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine
2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine (PubChem CID 162025173) has the molecular formula C22H16BBrCl2F2N2O2
and a molecular weight of 540.00 g/mol. Its IUPAC name is 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine.
Molecular Properties
| Compound Name | 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine |
| PubChem CID | 162025173 |
| Molecular Formula | C22H16BBrCl2F2N2O2 |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine |
| SMILES | Brc1ccccn1.Fc1cc(Cl)ccc1-c1ccccn1.OB(O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H7ClFN.C6H5BClFO2.C5H4BrN/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;8-4-1-2-5(7(10)11)6(9)3-4;6-5-3-1-2-4-7-5/h1-7H;1-3,10-11H;1-4H |
| InChIKey | YVGVPMAIPWOANH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine?
The IUPAC name of 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine (CID 162025173) is 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine.
What is the SMILES notation for 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine?
The canonical SMILES for 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine is Brc1ccccn1.Fc1cc(Cl)ccc1-c1ccccn1.OB(O)c1ccc(Cl)cc1F.
What is the InChIKey of 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine?
The InChIKey is YVGVPMAIPWOANH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClFN.C6H5BClFO2.C5H4BrN/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;8-4-1-2-5(7(10)11)6(9)3-4;6-5-3-1-2-4-7-5/h1-7H;1-3,10-11H;1-4H.
What are the key properties of 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine?
2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine has a molecular weight of 540.00 g/mol, XLogP of 5.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopyridine;(4-chloro-2-fluorophenyl)boronic acid;2-(4-chloro-2-fluorophenyl)pyridine is sourced from PubChem (CID 162025173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).