C23H22ClFN2 — CID 57181978
2-(4-chlorophenyl)-4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyridine (PubChem CID 57181978) has the molecular formula C23H22ClFN2 and a molecular weight of 380.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyridine.
| Compound Name | 2-(4-chlorophenyl)-4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 57181978 |
| Molecular Formula | C23H22ClFN2 |
| Molecular Weight | 380.89 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyridine |
| SMILES | Fc1ccc(C2CCN(Cc3ccnc(-c4ccc(Cl)cc4)c3)CC2)cc1 |
| InChI | InChI=1S/C23H22ClFN2/c24-21-5-1-20(2-6-21)23-15-17(9-12-26-23)16-27-13-10-19(11-14-27)18-3-7-22(25)8-4-18/h1-9,12,15,19H,10-11,13-14,16H2 |
| InChIKey | KUBWIUOJADOMBC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.89 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |