C25H25Cl2N3O — CID 23108518
2-chloro-N-[[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 23108518) has the molecular formula C25H25Cl2N3O and a molecular weight of 454.40 g/mol. Its IUPAC name is 2-chloro-N-[[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 23108518 |
| Molecular Formula | C25H25Cl2N3O |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-chloro-N-[[4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccc(C2CCN(Cc3ccc(Cl)cc3)CC2)cc1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C25H25Cl2N3O/c26-23-7-3-19(4-8-23)17-30-13-10-21(11-14-30)20-5-1-18(2-6-20)16-29-25(31)22-9-12-28-24(27)15-22/h1-9,12,15,21H,10-11,13-14,16-17H2,(H,29,31) |
| InChIKey | PSSILCWLUINHHP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|