C21H50N2O2 — CID 162025713
methane;3-methyl-N-(3-methylbutan-2-yl)butanamide;3-methyl-N-propylbutanamide (PubChem CID 162025713) has the molecular formula C21H50N2O2 and a molecular weight of 362.64 g/mol. Its IUPAC name is methane;3-methyl-N-(3-methylbutan-2-yl)butanamide;3-methyl-N-propylbutanamide.
| Compound Name | methane;3-methyl-N-(3-methylbutan-2-yl)butanamide;3-methyl-N-propylbutanamide |
|---|---|
| PubChem CID | 162025713 |
| Molecular Formula | C21H50N2O2 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 362.39 |
| IUPAC Name | methane;3-methyl-N-(3-methylbutan-2-yl)butanamide;3-methyl-N-propylbutanamide |
| SMILES | C.C.C.CC(C)CC(=O)NC(C)C(C)C.CCCNC(=O)CC(C)C |
| InChI | InChI=1S/C10H21NO.C8H17NO.3CH4/c1-7(2)6-10(12)11-9(5)8(3)4;1-4-5-9-8(10)6-7(2)3;;;/h7-9H,6H2,1-5H3,(H,11,12);7H,4-6H2,1-3H3,(H,9,10);3*1H4 |
| InChIKey | YVIMWAXWWHDTAL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |