About 1,1'-biphenyl;3-chlorocyclopentene
1,1'-biphenyl;3-chlorocyclopentene (PubChem CID 162026727) has the molecular formula C17H17Cl
and a molecular weight of 256.78 g/mol. Its IUPAC name is 1,1'-biphenyl;3-chlorocyclopentene.
Molecular Properties
| Compound Name | 1,1'-biphenyl;3-chlorocyclopentene |
| PubChem CID | 162026727 |
| Molecular Formula | C17H17Cl |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1,1'-biphenyl;3-chlorocyclopentene |
| SMILES | ClC1C=CCC1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C5H7Cl/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;6-5-3-1-2-4-5/h1-10H;1,3,5H,2,4H2 |
| InChIKey | YVMAZPXRHDNFED-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;3-chlorocyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;3-chlorocyclopentene?
The IUPAC name of 1,1'-biphenyl;3-chlorocyclopentene (CID 162026727) is 1,1'-biphenyl;3-chlorocyclopentene.
What is the SMILES notation for 1,1'-biphenyl;3-chlorocyclopentene?
The canonical SMILES for 1,1'-biphenyl;3-chlorocyclopentene is ClC1C=CCC1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;3-chlorocyclopentene?
The InChIKey is YVMAZPXRHDNFED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C5H7Cl/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;6-5-3-1-2-4-5/h1-10H;1,3,5H,2,4H2.
What are the key properties of 1,1'-biphenyl;3-chlorocyclopentene?
1,1'-biphenyl;3-chlorocyclopentene has a molecular weight of 256.78 g/mol, XLogP of 5.30, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;3-chlorocyclopentene is sourced from PubChem (CID 162026727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).