C21H15N4+ — CID 162028144
3-phenyl-1,3,7-triaza-10-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7,11,13,15,17-octaene (PubChem CID 162028144) has the molecular formula C21H15N4+ and a molecular weight of 323.38 g/mol. Its IUPAC name is 3-phenyl-1,3,7-triaza-10-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7,11,13,15,17-octaene.
| Compound Name | 3-phenyl-1,3,7-triaza-10-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7,11,13,15,17-octaene |
|---|---|
| PubChem CID | 162028144 |
| Molecular Formula | C21H15N4+ |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-phenyl-1,3,7-triaza-10-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7,11,13,15,17-octaene |
| SMILES | c1ccc(-n2c3ccncc3[n+]3cc4n(c23)Cc2ccccc2-4)cc1 |
| InChI | InChI=1S/C21H15N4/c1-2-7-16(8-3-1)25-18-10-11-22-12-19(18)24-14-20-17-9-5-4-6-15(17)13-23(20)21(24)25/h1-12,14H,13H2/q+1 |
| InChIKey | MZHNPOQOSGKEKE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|