C22H17N4+ — CID 157260685
11-methyl-9-phenyl-1,5,9-triaza-11-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,13,15,17-octaene (PubChem CID 157260685) has the molecular formula C22H17N4+ and a molecular weight of 337.41 g/mol. Its IUPAC name is 11-methyl-9-phenyl-1,5,9-triaza-11-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,13,15,17-octaene.
| Compound Name | 11-methyl-9-phenyl-1,5,9-triaza-11-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,13,15,17-octaene |
|---|---|
| PubChem CID | 157260685 |
| Molecular Formula | C22H17N4+ |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 11-methyl-9-phenyl-1,5,9-triaza-11-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,13,15,17-octaene |
| SMILES | C[n+]1c2n(c3c4cnccc4n(-c4ccccc4)c31)Cc1ccccc1-2 |
| InChI | InChI=1S/C22H17N4/c1-24-21-17-10-6-5-7-15(17)14-25(21)20-18-13-23-12-11-19(18)26(22(20)24)16-8-3-2-4-9-16/h2-13H,14H2,1H3/q+1 |
| InChIKey | YNJQTSQPILXKDI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|