C21H16N5+ — CID 159361019
11-methyl-9-phenyl-1,7,9,17-tetraza-11-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,13(18),14,16-octaene (PubChem CID 159361019) has the molecular formula C21H16N5+ and a molecular weight of 338.39 g/mol. Its IUPAC name is 11-methyl-9-phenyl-1,7,9,17-tetraza-11-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,13(18),14,16-octaene.
| Compound Name | 11-methyl-9-phenyl-1,7,9,17-tetraza-11-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,13(18),14,16-octaene |
|---|---|
| PubChem CID | 159361019 |
| Molecular Formula | C21H16N5+ |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 11-methyl-9-phenyl-1,7,9,17-tetraza-11-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,13(18),14,16-octaene |
| SMILES | C[n+]1c2n(c3c4cccnc4n(-c4ccccc4)c31)Cc1ncccc1-2 |
| InChI | InChI=1S/C21H16N5/c1-24-20-15-9-5-11-22-17(15)13-25(20)18-16-10-6-12-23-19(16)26(21(18)24)14-7-3-2-4-8-14/h2-12H,13H2,1H3/q+1 |
| InChIKey | FNVJZGPONDQHKE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|