C8H18O — CID 162034514
1,1,1,3,3-pentadeuterio-2,4,4-trimethylpentan-2-ol (PubChem CID 162034514) has the molecular formula C8H18O and a molecular weight of 135.26 g/mol. Its IUPAC name is 1,1,1,3,3-pentadeuterio-2,4,4-trimethylpentan-2-ol.
| Compound Name | 1,1,1,3,3-pentadeuterio-2,4,4-trimethylpentan-2-ol |
|---|---|
| PubChem CID | 162034514 |
| Molecular Formula | C8H18O |
| Molecular Weight | 135.26 g/mol |
| Exact Mass | 135.17 |
| IUPAC Name | 1,1,1,3,3-pentadeuterio-2,4,4-trimethylpentan-2-ol |
| SMILES | [2H]C([2H])([2H])C(C)(O)C([2H])([2H])C(C)(C)C |
| InChI | InChI=1S/C8H18O/c1-7(2,3)6-8(4,5)9/h9H,6H2,1-5H3/i4D3,6D2 |
| InChIKey | BSYJHYLAMMJNRC-NSMKSNBVSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |