C10H22 — CID 176822398
1,1,1,3,3,4,4,6,6,6-decadeuterio-2,5-dimethyl-2,5-bis(trideuteriomethyl)hexane (PubChem CID 176822398) has the molecular formula C10H22 and a molecular weight of 158.38 g/mol. Its IUPAC name is 1,1,1,3,3,4,4,6,6,6-decadeuterio-2,5-dimethyl-2,5-bis(trideuteriomethyl)hexane.
| Compound Name | 1,1,1,3,3,4,4,6,6,6-decadeuterio-2,5-dimethyl-2,5-bis(trideuteriomethyl)hexane |
|---|---|
| PubChem CID | 176822398 |
| Molecular Formula | C10H22 |
| Molecular Weight | 158.38 g/mol |
| Exact Mass | 158.27 |
| IUPAC Name | 1,1,1,3,3,4,4,6,6,6-decadeuterio-2,5-dimethyl-2,5-bis(trideuteriomethyl)hexane |
| SMILES | [2H]C([2H])([2H])C(C)(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C(C)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H22/c1-9(2,3)7-8-10(4,5)6/h7-8H2,1-6H3/i1D3,2D3,4D3,5D3,7D2,8D2 |
| InChIKey | HXQDUXXBVMMIKL-WNCFLOHJSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |