C27H26N2O2S — CID 162034784
8-[[(3R)-1-[(4-phenylphenyl)methyl]pyrrolidin-3-yl]methylsulfonyl]quinoline (PubChem CID 162034784) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is 8-[[(3R)-1-[(4-phenylphenyl)methyl]pyrrolidin-3-yl]methylsulfonyl]quinoline.
| Compound Name | 8-[[(3R)-1-[(4-phenylphenyl)methyl]pyrrolidin-3-yl]methylsulfonyl]quinoline |
|---|---|
| PubChem CID | 162034784 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 8-[[(3R)-1-[(4-phenylphenyl)methyl]pyrrolidin-3-yl]methylsulfonyl]quinoline |
| SMILES | O=S(=O)(C[C@@H]1CCN(Cc2ccc(-c3ccccc3)cc2)C1)c1cccc2cccnc12 |
| InChI | InChI=1S/C27H26N2O2S/c30-32(31,26-10-4-8-25-9-5-16-28-27(25)26)20-22-15-17-29(19-22)18-21-11-13-24(14-12-21)23-6-2-1-3-7-23/h1-14,16,22H,15,17-20H2/t22-/m1/s1 |
| InChIKey | YWMSXESJWCTOKA-JOCHJYFZSA-N |
| XLogP | 5.20 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |